C31H40N6OS — CID 163246760
5-(3-cyclopropyl-3-methylbutyl)-19-(2,6-dimethylphenyl)-2-oxa-15-thia-5,9,16,18,21,22-hexazatetracyclo[15.3.1.13,7.110,14]tricosa-1(21),10(22),11,13,17,19-hexaene (PubChem CID 163246760) has the molecular formula C31H40N6OS and a molecular weight of 544.77 g/mol. Its IUPAC name is 5-(3-cyclopropyl-3-methylbutyl)-19-(2,6-dimethylphenyl)-2-oxa-15-thia-5,9,16,18,21,22-hexazatetracyclo[15.3.1.13,7.110,14]tricosa-1(21),10(22),11,13,17,19-hexaene.
| Compound Name | 5-(3-cyclopropyl-3-methylbutyl)-19-(2,6-dimethylphenyl)-2-oxa-15-thia-5,9,16,18,21,22-hexazatetracyclo[15.3.1.13,7.110,14]tricosa-1(21),10(22),11,13,17,19-hexaene |
|---|---|
| PubChem CID | 163246760 |
| Molecular Formula | C31H40N6OS |
| Molecular Weight | 544.77 g/mol |
| Exact Mass | 544.30 |
| IUPAC Name | 5-(3-cyclopropyl-3-methylbutyl)-19-(2,6-dimethylphenyl)-2-oxa-15-thia-5,9,16,18,21,22-hexazatetracyclo[15.3.1.13,7.110,14]tricosa-1(21),10(22),11,13,17,19-hexaene |
| SMILES | Cc1cccc(C)c1-c1cc2nc(n1)NSc1cccc(n1)NCC1CC(CN(CCC(C)(C)C3CC3)C1)O2 |
| InChI | InChI=1S/C31H40N6OS/c1-20-7-5-8-21(2)29(20)25-16-27-35-30(33-25)36-39-28-10-6-9-26(34-28)32-17-22-15-24(38-27)19-37(18-22)14-13-31(3,4)23-11-12-23/h5-10,16,22-24H,11-15,17-19H2,1-4H3,(H,32,34)(H,33,35,36) |
| InChIKey | FZBDQPHIVAOVET-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 75.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.77 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|