C25H27N5O2S — CID 167013737
(16R)-12-(2,6-dimethylphenyl)-18-methyl-15-oxa-8-thia-1,9,11,18,22-pentazatetracyclo[14.4.1.13,7.110,14]tricosa-3(23),4,6,10,12,14(22)-hexaen-2-one (PubChem CID 167013737) has the molecular formula C25H27N5O2S and a molecular weight of 461.59 g/mol. Its IUPAC name is (16R)-12-(2,6-dimethylphenyl)-18-methyl-15-oxa-8-thia-1,9,11,18,22-pentazatetracyclo[14.4.1.13,7.110,14]tricosa-3(23),4,6,10,12,14(22)-hexaen-2-one.
| Compound Name | (16R)-12-(2,6-dimethylphenyl)-18-methyl-15-oxa-8-thia-1,9,11,18,22-pentazatetracyclo[14.4.1.13,7.110,14]tricosa-3(23),4,6,10,12,14(22)-hexaen-2-one |
|---|---|
| PubChem CID | 167013737 |
| Molecular Formula | C25H27N5O2S |
| Molecular Weight | 461.59 g/mol |
| Exact Mass | 461.19 |
| IUPAC Name | (16R)-12-(2,6-dimethylphenyl)-18-methyl-15-oxa-8-thia-1,9,11,18,22-pentazatetracyclo[14.4.1.13,7.110,14]tricosa-3(23),4,6,10,12,14(22)-hexaen-2-one |
| SMILES | Cc1cccc(C)c1-c1cc2nc(n1)NSc1cccc(c1)C(=O)N1CCN(C)C[C@H](C1)O2 |
| InChI | InChI=1S/C25H27N5O2S/c1-16-6-4-7-17(2)23(16)21-13-22-27-25(26-21)28-33-20-9-5-8-18(12-20)24(31)30-11-10-29(3)14-19(15-30)32-22/h4-9,12-13,19H,10-11,14-15H2,1-3H3,(H,26,27,28)/t19-/m1/s1 |
| InChIKey | BSUZFKBJWVKHKP-LJQANCHMSA-N |
| XLogP | 4.03 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.59 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|