C28H27N5O2S — CID 167012513
6-(2,6-dimethylphenyl)-13-(pyridin-2-ylmethyl)-9-oxa-2-thia-3,5,13,20-tetrazatricyclo[13.3.1.14,8]icosa-1(18),4,6,8(20),15(19),16-hexaen-14-one (PubChem CID 167012513) has the molecular formula C28H27N5O2S and a molecular weight of 497.62 g/mol. Its IUPAC name is 6-(2,6-dimethylphenyl)-13-(pyridin-2-ylmethyl)-9-oxa-2-thia-3,5,13,20-tetrazatricyclo[13.3.1.14,8]icosa-1(18),4,6,8(20),15(19),16-hexaen-14-one.
| Compound Name | 6-(2,6-dimethylphenyl)-13-(pyridin-2-ylmethyl)-9-oxa-2-thia-3,5,13,20-tetrazatricyclo[13.3.1.14,8]icosa-1(18),4,6,8(20),15(19),16-hexaen-14-one |
|---|---|
| PubChem CID | 167012513 |
| Molecular Formula | C28H27N5O2S |
| Molecular Weight | 497.62 g/mol |
| Exact Mass | 497.19 |
| IUPAC Name | 6-(2,6-dimethylphenyl)-13-(pyridin-2-ylmethyl)-9-oxa-2-thia-3,5,13,20-tetrazatricyclo[13.3.1.14,8]icosa-1(18),4,6,8(20),15(19),16-hexaen-14-one |
| SMILES | Cc1cccc(C)c1-c1cc2nc(n1)NSc1cccc(c1)C(=O)N(Cc1ccccn1)CCCO2 |
| InChI | InChI=1S/C28H27N5O2S/c1-19-8-5-9-20(2)26(19)24-17-25-31-28(30-24)32-36-23-12-6-10-21(16-23)27(34)33(14-7-15-35-25)18-22-11-3-4-13-29-22/h3-6,8-13,16-17H,7,14-15,18H2,1-2H3,(H,30,31,32) |
| InChIKey | NUTJOPIOVQMWIL-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 80.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.62 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|