C25H28N4OS — CID 163246817
5-(2,6-dimethylphenyl)-2-oxa-9-thia-6,8,15,23-tetrazatetracyclo[15.3.1.13,7.110,14]tricosa-3(23),4,6,10,12,14(22)-hexaene (PubChem CID 163246817) has the molecular formula C25H28N4OS and a molecular weight of 432.59 g/mol. Its IUPAC name is 5-(2,6-dimethylphenyl)-2-oxa-9-thia-6,8,15,23-tetrazatetracyclo[15.3.1.13,7.110,14]tricosa-3(23),4,6,10,12,14(22)-hexaene.
| Compound Name | 5-(2,6-dimethylphenyl)-2-oxa-9-thia-6,8,15,23-tetrazatetracyclo[15.3.1.13,7.110,14]tricosa-3(23),4,6,10,12,14(22)-hexaene |
|---|---|
| PubChem CID | 163246817 |
| Molecular Formula | C25H28N4OS |
| Molecular Weight | 432.59 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | 5-(2,6-dimethylphenyl)-2-oxa-9-thia-6,8,15,23-tetrazatetracyclo[15.3.1.13,7.110,14]tricosa-3(23),4,6,10,12,14(22)-hexaene |
| SMILES | Cc1cccc(C)c1-c1cc2nc(n1)NSc1cccc(c1)NCC1CCCC(C1)O2 |
| InChI | InChI=1S/C25H28N4OS/c1-16-6-3-7-17(2)24(16)22-14-23-28-25(27-22)29-31-21-11-5-9-19(13-21)26-15-18-8-4-10-20(12-18)30-23/h3,5-7,9,11,13-14,18,20,26H,4,8,10,12,15H2,1-2H3,(H,27,28,29) |
| InChIKey | OPQWSBUUWJONRY-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 59.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.59 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|