C34H44N4O3S — CID 163244746
4-[[(11R)-6-(2,6-dimethylphenyl)-11-(2,2-dimethylpropyl)-13-methoxy-9-oxa-2-thia-3,5,12,19-tetrazatricyclo[12.3.1.14,8]nonadeca-1(17),4,6,8(19),14(18),15-hexaen-12-yl]methyl]cyclohexan-1-one (PubChem CID 163244746) has the molecular formula C34H44N4O3S and a molecular weight of 588.82 g/mol. Its IUPAC name is 4-[[(11R)-6-(2,6-dimethylphenyl)-11-(2,2-dimethylpropyl)-13-methoxy-9-oxa-2-thia-3,5,12,19-tetrazatricyclo[12.3.1.14,8]nonadeca-1(17),4,6,8(19),14(18),15-hexaen-12-yl]methyl]cyclohexan-1-one.
| Compound Name | 4-[[(11R)-6-(2,6-dimethylphenyl)-11-(2,2-dimethylpropyl)-13-methoxy-9-oxa-2-thia-3,5,12,19-tetrazatricyclo[12.3.1.14,8]nonadeca-1(17),4,6,8(19),14(18),15-hexaen-12-yl]methyl]cyclohexan-1-one |
|---|---|
| PubChem CID | 163244746 |
| Molecular Formula | C34H44N4O3S |
| Molecular Weight | 588.82 g/mol |
| Exact Mass | 588.31 |
| IUPAC Name | 4-[[(11R)-6-(2,6-dimethylphenyl)-11-(2,2-dimethylpropyl)-13-methoxy-9-oxa-2-thia-3,5,12,19-tetrazatricyclo[12.3.1.14,8]nonadeca-1(17),4,6,8(19),14(18),15-hexaen-12-yl]methyl]cyclohexan-1-one |
| SMILES | COC1c2cccc(c2)SNc2nc(cc(-c3c(C)cccc3C)n2)OC[C@@H](CC(C)(C)C)N1CC1CCC(=O)CC1 |
| InChI | InChI=1S/C34H44N4O3S/c1-22-9-7-10-23(2)31(22)29-18-30-36-33(35-29)37-42-28-12-8-11-25(17-28)32(40-6)38(20-24-13-15-27(39)16-14-24)26(21-41-30)19-34(3,4)5/h7-12,17-18,24,26,32H,13-16,19-21H2,1-6H3,(H,35,36,37)/t26-,32?/m1/s1 |
| InChIKey | UXOSGZIUZKWMHT-PSPFREQMSA-N |
| XLogP | 7.78 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.82 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|