C32H34ClFN4OS — CID 163244098
12-[(6-chloro-3-fluoro-2-pyridinyl)methyl]-6-(2,6-dimethylphenyl)-11-(2,2-dimethylpropyl)-9-oxa-2-thia-3,5,18-triazatricyclo[11.3.1.14,8]octadeca-1(16),4,6,8(18),13(17),14-hexaene (PubChem CID 163244098) has the molecular formula C32H34ClFN4OS and a molecular weight of 577.17 g/mol. Its IUPAC name is 12-[(6-chloro-3-fluoro-2-pyridinyl)methyl]-6-(2,6-dimethylphenyl)-11-(2,2-dimethylpropyl)-9-oxa-2-thia-3,5,18-triazatricyclo[11.3.1.14,8]octadeca-1(16),4,6,8(18),13(17),14-hexaene.
| Compound Name | 12-[(6-chloro-3-fluoro-2-pyridinyl)methyl]-6-(2,6-dimethylphenyl)-11-(2,2-dimethylpropyl)-9-oxa-2-thia-3,5,18-triazatricyclo[11.3.1.14,8]octadeca-1(16),4,6,8(18),13(17),14-hexaene |
|---|---|
| PubChem CID | 163244098 |
| Molecular Formula | C32H34ClFN4OS |
| Molecular Weight | 577.17 g/mol |
| Exact Mass | 576.21 |
| IUPAC Name | 12-[(6-chloro-3-fluoro-2-pyridinyl)methyl]-6-(2,6-dimethylphenyl)-11-(2,2-dimethylpropyl)-9-oxa-2-thia-3,5,18-triazatricyclo[11.3.1.14,8]octadeca-1(16),4,6,8(18),13(17),14-hexaene |
| SMILES | Cc1cccc(C)c1-c1cc2nc(n1)NSc1cccc(c1)C(Cc1nc(Cl)ccc1F)C(CC(C)(C)C)CO2 |
| InChI | InChI=1S/C32H34ClFN4OS/c1-19-8-6-9-20(2)30(19)27-16-29-37-31(36-27)38-40-23-11-7-10-21(14-23)24(22(18-39-29)17-32(3,4)5)15-26-25(34)12-13-28(33)35-26/h6-14,16,22,24H,15,17-18H2,1-5H3,(H,36,37,38) |
| InChIKey | SIZOCQQIVULBNT-UHFFFAOYSA-N |
| XLogP | 8.84 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.17 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|