C40H50N6O3S — CID 167012674
6-(2,6-dimethylphenyl)-11-(2,2-dimethylpropyl)-12-[(3,5-dimorpholin-4-yl-2-pyridinyl)methyl]-9-oxa-2-thia-3,5,18-triazatricyclo[11.3.1.14,8]octadeca-1(16),4,6,8(18),13(17),14-hexaene (PubChem CID 167012674) has the molecular formula C40H50N6O3S and a molecular weight of 694.95 g/mol. Its IUPAC name is 6-(2,6-dimethylphenyl)-11-(2,2-dimethylpropyl)-12-[(3,5-dimorpholin-4-yl-2-pyridinyl)methyl]-9-oxa-2-thia-3,5,18-triazatricyclo[11.3.1.14,8]octadeca-1(16),4,6,8(18),13(17),14-hexaene.
| Compound Name | 6-(2,6-dimethylphenyl)-11-(2,2-dimethylpropyl)-12-[(3,5-dimorpholin-4-yl-2-pyridinyl)methyl]-9-oxa-2-thia-3,5,18-triazatricyclo[11.3.1.14,8]octadeca-1(16),4,6,8(18),13(17),14-hexaene |
|---|---|
| PubChem CID | 167012674 |
| Molecular Formula | C40H50N6O3S |
| Molecular Weight | 694.95 g/mol |
| Exact Mass | 694.37 |
| IUPAC Name | 6-(2,6-dimethylphenyl)-11-(2,2-dimethylpropyl)-12-[(3,5-dimorpholin-4-yl-2-pyridinyl)methyl]-9-oxa-2-thia-3,5,18-triazatricyclo[11.3.1.14,8]octadeca-1(16),4,6,8(18),13(17),14-hexaene |
| SMILES | Cc1cccc(C)c1-c1cc2nc(n1)NSc1cccc(c1)C(Cc1ncc(N3CCOCC3)cc1N1CCOCC1)C(CC(C)(C)C)CO2 |
| InChI | InChI=1S/C40H50N6O3S/c1-27-8-6-9-28(2)38(27)35-23-37-43-39(42-35)44-50-32-11-7-10-29(20-32)33(30(26-49-37)24-40(3,4)5)22-34-36(46-14-18-48-19-15-46)21-31(25-41-34)45-12-16-47-17-13-45/h6-11,20-21,23,25,30,33H,12-19,22,24,26H2,1-5H3,(H,42,43,44) |
| InChIKey | FJWLCEOMBQCEBN-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 84.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.95 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|