C28H36N4O4S — CID 163244100
3-[[4-(2-amino-4,4-dimethylpentoxy)-6-(2,6-dimethylphenyl)pyrimidin-2-yl]-(methoxymethyl)amino]sulfanylbenzoic acid (PubChem CID 163244100) has the molecular formula C28H36N4O4S and a molecular weight of 524.69 g/mol. Its IUPAC name is 3-[[4-(2-amino-4,4-dimethylpentoxy)-6-(2,6-dimethylphenyl)pyrimidin-2-yl]-(methoxymethyl)amino]sulfanylbenzoic acid.
| Compound Name | 3-[[4-(2-amino-4,4-dimethylpentoxy)-6-(2,6-dimethylphenyl)pyrimidin-2-yl]-(methoxymethyl)amino]sulfanylbenzoic acid |
|---|---|
| PubChem CID | 163244100 |
| Molecular Formula | C28H36N4O4S |
| Molecular Weight | 524.69 g/mol |
| Exact Mass | 524.25 |
| IUPAC Name | 3-[[4-(2-amino-4,4-dimethylpentoxy)-6-(2,6-dimethylphenyl)pyrimidin-2-yl]-(methoxymethyl)amino]sulfanylbenzoic acid |
| SMILES | COCN(Sc1cccc(C(=O)O)c1)c1nc(OCC(N)CC(C)(C)C)cc(-c2c(C)cccc2C)n1 |
| InChI | InChI=1S/C28H36N4O4S/c1-18-9-7-10-19(2)25(18)23-14-24(36-16-21(29)15-28(3,4)5)31-27(30-23)32(17-35-6)37-22-12-8-11-20(13-22)26(33)34/h7-14,21H,15-17,29H2,1-6H3,(H,33,34) |
| InChIKey | VWNVYXSHCZBBKX-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.69 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|