C34H40N4O3S — CID 163244704
3-[[4-[4,4-dimethyl-2-[(4-methylphenyl)methylamino]pentoxy]-6-(2,6-dimethylphenyl)pyrimidin-2-yl]amino]sulfanylbenzoic acid (PubChem CID 163244704) has the molecular formula C34H40N4O3S and a molecular weight of 584.79 g/mol. Its IUPAC name is 3-[[4-[4,4-dimethyl-2-[(4-methylphenyl)methylamino]pentoxy]-6-(2,6-dimethylphenyl)pyrimidin-2-yl]amino]sulfanylbenzoic acid.
| Compound Name | 3-[[4-[4,4-dimethyl-2-[(4-methylphenyl)methylamino]pentoxy]-6-(2,6-dimethylphenyl)pyrimidin-2-yl]amino]sulfanylbenzoic acid |
|---|---|
| PubChem CID | 163244704 |
| Molecular Formula | C34H40N4O3S |
| Molecular Weight | 584.79 g/mol |
| Exact Mass | 584.28 |
| IUPAC Name | 3-[[4-[4,4-dimethyl-2-[(4-methylphenyl)methylamino]pentoxy]-6-(2,6-dimethylphenyl)pyrimidin-2-yl]amino]sulfanylbenzoic acid |
| SMILES | Cc1ccc(CNC(COc2cc(-c3c(C)cccc3C)nc(NSc3cccc(C(=O)O)c3)n2)CC(C)(C)C)cc1 |
| InChI | InChI=1S/C34H40N4O3S/c1-22-13-15-25(16-14-22)20-35-27(19-34(4,5)6)21-41-30-18-29(31-23(2)9-7-10-24(31)3)36-33(37-30)38-42-28-12-8-11-26(17-28)32(39)40/h7-18,27,35H,19-21H2,1-6H3,(H,39,40)(H,36,37,38) |
| InChIKey | YNXZHEGEGKXXCU-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 96.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.79 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|