C32H35BrN4O3S — CID 167012408
3-[[4-[(2R)-2-[(4-bromophenyl)methylamino]-4-methylpentoxy]-6-(2,6-dimethylphenyl)pyrimidin-2-yl]amino]sulfanylbenzoic acid (PubChem CID 167012408) has the molecular formula C32H35BrN4O3S and a molecular weight of 635.63 g/mol. Its IUPAC name is 3-[[4-[(2R)-2-[(4-bromophenyl)methylamino]-4-methylpentoxy]-6-(2,6-dimethylphenyl)pyrimidin-2-yl]amino]sulfanylbenzoic acid.
| Compound Name | 3-[[4-[(2R)-2-[(4-bromophenyl)methylamino]-4-methylpentoxy]-6-(2,6-dimethylphenyl)pyrimidin-2-yl]amino]sulfanylbenzoic acid |
|---|---|
| PubChem CID | 167012408 |
| Molecular Formula | C32H35BrN4O3S |
| Molecular Weight | 635.63 g/mol |
| Exact Mass | 634.16 |
| IUPAC Name | 3-[[4-[(2R)-2-[(4-bromophenyl)methylamino]-4-methylpentoxy]-6-(2,6-dimethylphenyl)pyrimidin-2-yl]amino]sulfanylbenzoic acid |
| SMILES | Cc1cccc(C)c1-c1cc(OC[C@@H](CC(C)C)NCc2ccc(Br)cc2)nc(NSc2cccc(C(=O)O)c2)n1 |
| InChI | InChI=1S/C32H35BrN4O3S/c1-20(2)15-26(34-18-23-11-13-25(33)14-12-23)19-40-29-17-28(30-21(3)7-5-8-22(30)4)35-32(36-29)37-41-27-10-6-9-24(16-27)31(38)39/h5-14,16-17,20,26,34H,15,18-19H2,1-4H3,(H,38,39)(H,35,36,37)/t26-/m1/s1 |
| InChIKey | PHZLWEMOXHYMGJ-AREMUKBSSA-N |
| XLogP | 7.92 |
| TPSA | 96.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.63 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|