C26H32N4O2S — CID 163242875
3-[[4-(3-amino-5-methylhexyl)-6-(2,6-dimethylphenyl)pyrimidin-2-yl]amino]sulfanylbenzoic acid (PubChem CID 163242875) has the molecular formula C26H32N4O2S and a molecular weight of 464.64 g/mol. Its IUPAC name is 3-[[4-(3-amino-5-methylhexyl)-6-(2,6-dimethylphenyl)pyrimidin-2-yl]amino]sulfanylbenzoic acid.
| Compound Name | 3-[[4-(3-amino-5-methylhexyl)-6-(2,6-dimethylphenyl)pyrimidin-2-yl]amino]sulfanylbenzoic acid |
|---|---|
| PubChem CID | 163242875 |
| Molecular Formula | C26H32N4O2S |
| Molecular Weight | 464.64 g/mol |
| Exact Mass | 464.22 |
| IUPAC Name | 3-[[4-(3-amino-5-methylhexyl)-6-(2,6-dimethylphenyl)pyrimidin-2-yl]amino]sulfanylbenzoic acid |
| SMILES | Cc1cccc(C)c1-c1cc(CCC(N)CC(C)C)nc(NSc2cccc(C(=O)O)c2)n1 |
| InChI | InChI=1S/C26H32N4O2S/c1-16(2)13-20(27)11-12-21-15-23(24-17(3)7-5-8-18(24)4)29-26(28-21)30-33-22-10-6-9-19(14-22)25(31)32/h5-10,14-16,20H,11-13,27H2,1-4H3,(H,31,32)(H,28,29,30) |
| InChIKey | UPYCOAYNFDPYDJ-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 101.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.64 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|