C21H20ClN3O2S — CID 167017322
3-[[4-chloro-6-(2,6-dimethylphenyl)-5-ethylpyrimidin-2-yl]amino]sulfanylbenzoic acid (PubChem CID 167017322) has the molecular formula C21H20ClN3O2S and a molecular weight of 413.93 g/mol. Its IUPAC name is 3-[[4-chloro-6-(2,6-dimethylphenyl)-5-ethylpyrimidin-2-yl]amino]sulfanylbenzoic acid.
| Compound Name | 3-[[4-chloro-6-(2,6-dimethylphenyl)-5-ethylpyrimidin-2-yl]amino]sulfanylbenzoic acid |
|---|---|
| PubChem CID | 167017322 |
| Molecular Formula | C21H20ClN3O2S |
| Molecular Weight | 413.93 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | 3-[[4-chloro-6-(2,6-dimethylphenyl)-5-ethylpyrimidin-2-yl]amino]sulfanylbenzoic acid |
| SMILES | CCc1c(Cl)nc(NSc2cccc(C(=O)O)c2)nc1-c1c(C)cccc1C |
| InChI | InChI=1S/C21H20ClN3O2S/c1-4-16-18(17-12(2)7-5-8-13(17)3)23-21(24-19(16)22)25-28-15-10-6-9-14(11-15)20(26)27/h5-11H,4H2,1-3H3,(H,26,27)(H,23,24,25) |
| InChIKey | PXPQLSHRLUQCHV-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.93 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|