C21H19ClN2O2S — CID 163242642
methyl 3-[[4-chloro-6-(2,6-dimethylphenyl)-2-pyridinyl]amino]sulfanylbenzoate (PubChem CID 163242642) has the molecular formula C21H19ClN2O2S and a molecular weight of 398.92 g/mol. Its IUPAC name is methyl 3-[[4-chloro-6-(2,6-dimethylphenyl)-2-pyridinyl]amino]sulfanylbenzoate.
| Compound Name | methyl 3-[[4-chloro-6-(2,6-dimethylphenyl)-2-pyridinyl]amino]sulfanylbenzoate |
|---|---|
| PubChem CID | 163242642 |
| Molecular Formula | C21H19ClN2O2S |
| Molecular Weight | 398.92 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | methyl 3-[[4-chloro-6-(2,6-dimethylphenyl)-2-pyridinyl]amino]sulfanylbenzoate |
| SMILES | COC(=O)c1cccc(SNc2cc(Cl)cc(-c3c(C)cccc3C)n2)c1 |
| InChI | InChI=1S/C21H19ClN2O2S/c1-13-6-4-7-14(2)20(13)18-11-16(22)12-19(23-18)24-27-17-9-5-8-15(10-17)21(25)26-3/h4-12H,1-3H3,(H,23,24) |
| InChIKey | WIGPSWNFGBZHPU-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.92 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|