C25H28ClN3O2S — CID 163243082
methyl 3-[[4-chloro-5-methyl-6-[2-methyl-6-(3-methylbutyl)phenyl]pyrimidin-2-yl]amino]sulfanylbenzoate (PubChem CID 163243082) has the molecular formula C25H28ClN3O2S and a molecular weight of 470.04 g/mol. Its IUPAC name is methyl 3-[[4-chloro-5-methyl-6-[2-methyl-6-(3-methylbutyl)phenyl]pyrimidin-2-yl]amino]sulfanylbenzoate.
| Compound Name | methyl 3-[[4-chloro-5-methyl-6-[2-methyl-6-(3-methylbutyl)phenyl]pyrimidin-2-yl]amino]sulfanylbenzoate |
|---|---|
| PubChem CID | 163243082 |
| Molecular Formula | C25H28ClN3O2S |
| Molecular Weight | 470.04 g/mol |
| Exact Mass | 469.16 |
| IUPAC Name | methyl 3-[[4-chloro-5-methyl-6-[2-methyl-6-(3-methylbutyl)phenyl]pyrimidin-2-yl]amino]sulfanylbenzoate |
| SMILES | COC(=O)c1cccc(SNc2nc(Cl)c(C)c(-c3c(C)cccc3CCC(C)C)n2)c1 |
| InChI | InChI=1S/C25H28ClN3O2S/c1-15(2)12-13-18-9-6-8-16(3)21(18)22-17(4)23(26)28-25(27-22)29-32-20-11-7-10-19(14-20)24(30)31-5/h6-11,14-15H,12-13H2,1-5H3,(H,27,28,29) |
| InChIKey | WEQCGRVHEAZNJW-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.04 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|