C29H40N4O4S — CID 169233092
3-[[4-(2-amino-3-propan-2-yloxypropoxy)-6-(2,6-dimethylphenyl)-5-ethylpyrimidin-2-yl]amino]sulfanylbenzoic acid;ethane (PubChem CID 169233092) has the molecular formula C29H40N4O4S and a molecular weight of 540.73 g/mol. Its IUPAC name is 3-[[4-(2-amino-3-propan-2-yloxypropoxy)-6-(2,6-dimethylphenyl)-5-ethylpyrimidin-2-yl]amino]sulfanylbenzoic acid;ethane.
| Compound Name | 3-[[4-(2-amino-3-propan-2-yloxypropoxy)-6-(2,6-dimethylphenyl)-5-ethylpyrimidin-2-yl]amino]sulfanylbenzoic acid;ethane |
|---|---|
| PubChem CID | 169233092 |
| Molecular Formula | C29H40N4O4S |
| Molecular Weight | 540.73 g/mol |
| Exact Mass | 540.28 |
| IUPAC Name | 3-[[4-(2-amino-3-propan-2-yloxypropoxy)-6-(2,6-dimethylphenyl)-5-ethylpyrimidin-2-yl]amino]sulfanylbenzoic acid;ethane |
| SMILES | CC.CCc1c(OCC(N)COC(C)C)nc(NSc2cccc(C(=O)O)c2)nc1-c1c(C)cccc1C |
| InChI | InChI=1S/C27H34N4O4S.C2H6/c1-6-22-24(23-17(4)9-7-10-18(23)5)29-27(30-25(22)35-15-20(28)14-34-16(2)3)31-36-21-12-8-11-19(13-21)26(32)33;1-2/h7-13,16,20H,6,14-15,28H2,1-5H3,(H,32,33)(H,29,30,31);1-2H3 |
| InChIKey | ZRGXYRXJXGDBLN-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 119.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.73 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|