C30H36N4O3S — CID 169233592
3-[[4-[2-amino-3,3-di(cyclobutyl)propoxy]-6-(2,6-dimethylphenyl)pyrimidin-2-yl]amino]sulfanylbenzoic acid (PubChem CID 169233592) has the molecular formula C30H36N4O3S and a molecular weight of 532.71 g/mol. Its IUPAC name is 3-[[4-[2-amino-3,3-di(cyclobutyl)propoxy]-6-(2,6-dimethylphenyl)pyrimidin-2-yl]amino]sulfanylbenzoic acid.
| Compound Name | 3-[[4-[2-amino-3,3-di(cyclobutyl)propoxy]-6-(2,6-dimethylphenyl)pyrimidin-2-yl]amino]sulfanylbenzoic acid |
|---|---|
| PubChem CID | 169233592 |
| Molecular Formula | C30H36N4O3S |
| Molecular Weight | 532.71 g/mol |
| Exact Mass | 532.25 |
| IUPAC Name | 3-[[4-[2-amino-3,3-di(cyclobutyl)propoxy]-6-(2,6-dimethylphenyl)pyrimidin-2-yl]amino]sulfanylbenzoic acid |
| SMILES | Cc1cccc(C)c1-c1cc(OCC(N)C(C2CCC2)C2CCC2)nc(NSc2cccc(C(=O)O)c2)n1 |
| InChI | InChI=1S/C30H36N4O3S/c1-18-7-3-8-19(2)27(18)25-16-26(37-17-24(31)28(20-9-4-10-20)21-11-5-12-21)33-30(32-25)34-38-23-14-6-13-22(15-23)29(35)36/h3,6-8,13-16,20-21,24,28H,4-5,9-12,17,31H2,1-2H3,(H,35,36)(H,32,33,34) |
| InChIKey | NBGGIAPEWIRFMY-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 110.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.71 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|