C29H28N4O3S — CID 163245804
3-[[4-(2,6-dimethylphenyl)-6-(2,3,4,5-tetrahydro-1H-3-benzazepin-5-yloxy)pyrimidin-2-yl]amino]sulfanylbenzoic acid (PubChem CID 163245804) has the molecular formula C29H28N4O3S and a molecular weight of 512.64 g/mol. Its IUPAC name is 3-[[4-(2,6-dimethylphenyl)-6-(2,3,4,5-tetrahydro-1H-3-benzazepin-5-yloxy)pyrimidin-2-yl]amino]sulfanylbenzoic acid.
| Compound Name | 3-[[4-(2,6-dimethylphenyl)-6-(2,3,4,5-tetrahydro-1H-3-benzazepin-5-yloxy)pyrimidin-2-yl]amino]sulfanylbenzoic acid |
|---|---|
| PubChem CID | 163245804 |
| Molecular Formula | C29H28N4O3S |
| Molecular Weight | 512.64 g/mol |
| Exact Mass | 512.19 |
| IUPAC Name | 3-[[4-(2,6-dimethylphenyl)-6-(2,3,4,5-tetrahydro-1H-3-benzazepin-5-yloxy)pyrimidin-2-yl]amino]sulfanylbenzoic acid |
| SMILES | Cc1cccc(C)c1-c1cc(OC2CNCCc3ccccc32)nc(NSc2cccc(C(=O)O)c2)n1 |
| InChI | InChI=1S/C29H28N4O3S/c1-18-7-5-8-19(2)27(18)24-16-26(36-25-17-30-14-13-20-9-3-4-12-23(20)25)32-29(31-24)33-37-22-11-6-10-21(15-22)28(34)35/h3-12,15-16,25,30H,13-14,17H2,1-2H3,(H,34,35)(H,31,32,33) |
| InChIKey | QVNZXIHTGHATLQ-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 96.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.64 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|