C20H29N3OS — CID 163245720
4-(2-amino-4-methylpentoxy)-6-(2,6-dimethylphenyl)-N-methylsulfanylpyridin-2-amine (PubChem CID 163245720) has the molecular formula C20H29N3OS and a molecular weight of 359.54 g/mol. Its IUPAC name is 4-(2-amino-4-methylpentoxy)-6-(2,6-dimethylphenyl)-N-methylsulfanylpyridin-2-amine.
| Compound Name | 4-(2-amino-4-methylpentoxy)-6-(2,6-dimethylphenyl)-N-methylsulfanylpyridin-2-amine |
|---|---|
| PubChem CID | 163245720 |
| Molecular Formula | C20H29N3OS |
| Molecular Weight | 359.54 g/mol |
| Exact Mass | 359.20 |
| IUPAC Name | 4-(2-amino-4-methylpentoxy)-6-(2,6-dimethylphenyl)-N-methylsulfanylpyridin-2-amine |
| SMILES | CSNc1cc(OCC(N)CC(C)C)cc(-c2c(C)cccc2C)n1 |
| InChI | InChI=1S/C20H29N3OS/c1-13(2)9-16(21)12-24-17-10-18(22-19(11-17)23-25-5)20-14(3)7-6-8-15(20)4/h6-8,10-11,13,16H,9,12,21H2,1-5H3,(H,22,23) |
| InChIKey | FTKWYDJVRSYHDX-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.54 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|