C19H27N4O3S- — CID 170407957
4-(2,6-dimethylphenyl)-6-[(2R)-4-methyl-2-(methylamino)pentoxy]-2-(sulfinatoamino)pyrimidine (PubChem CID 170407957) has the molecular formula C19H27N4O3S- and a molecular weight of 391.52 g/mol. Its IUPAC name is 4-(2,6-dimethylphenyl)-6-[(2R)-4-methyl-2-(methylamino)pentoxy]-2-(sulfinatoamino)pyrimidine.
| Compound Name | 4-(2,6-dimethylphenyl)-6-[(2R)-4-methyl-2-(methylamino)pentoxy]-2-(sulfinatoamino)pyrimidine |
|---|---|
| PubChem CID | 170407957 |
| Molecular Formula | C19H27N4O3S- |
| Molecular Weight | 391.52 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | 4-(2,6-dimethylphenyl)-6-[(2R)-4-methyl-2-(methylamino)pentoxy]-2-(sulfinatoamino)pyrimidine |
| SMILES | CN[C@@H](COc1cc(-c2c(C)cccc2C)nc(NS(=O)[O-])n1)CC(C)C |
| InChI | InChI=1S/C19H28N4O3S/c1-12(2)9-15(20-5)11-26-17-10-16(21-19(22-17)23-27(24)25)18-13(3)7-6-8-14(18)4/h6-8,10,12,15,20H,9,11H2,1-5H3,(H,24,25)(H,21,22,23)/p-1/t15-/m1/s1 |
| InChIKey | NIACWWWPJODAKV-OAHLLOKOSA-M |
| XLogP | 2.98 |
| TPSA | 99.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.52 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|