C21H23N3OS — CID 163246892
4-pentoxy-6-phenyl-N-phenylsulfanylpyrimidin-2-amine (PubChem CID 163246892) has the molecular formula C21H23N3OS and a molecular weight of 365.50 g/mol. Its IUPAC name is 4-pentoxy-6-phenyl-N-phenylsulfanylpyrimidin-2-amine.
| Compound Name | 4-pentoxy-6-phenyl-N-phenylsulfanylpyrimidin-2-amine |
|---|---|
| PubChem CID | 163246892 |
| Molecular Formula | C21H23N3OS |
| Molecular Weight | 365.50 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | 4-pentoxy-6-phenyl-N-phenylsulfanylpyrimidin-2-amine |
| SMILES | CCCCCOc1cc(-c2ccccc2)nc(NSc2ccccc2)n1 |
| InChI | InChI=1S/C21H23N3OS/c1-2-3-10-15-25-20-16-19(17-11-6-4-7-12-17)22-21(23-20)24-26-18-13-8-5-9-14-18/h4-9,11-14,16H,2-3,10,15H2,1H3,(H,22,23,24) |
| InChIKey | LXCVHYYGAHZCBH-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.50 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|