C31H39N7O4S — CID 163247173
1-methyl-N-[4-[3-(4-methylpentoxy)phenyl]-6-[4-(4-methylpiperazin-1-yl)phenoxy]pyrimidin-2-yl]pyrazole-4-sulfonamide (PubChem CID 163247173) has the molecular formula C31H39N7O4S and a molecular weight of 605.77 g/mol. Its IUPAC name is 1-methyl-N-[4-[3-(4-methylpentoxy)phenyl]-6-[4-(4-methylpiperazin-1-yl)phenoxy]pyrimidin-2-yl]pyrazole-4-sulfonamide.
| Compound Name | 1-methyl-N-[4-[3-(4-methylpentoxy)phenyl]-6-[4-(4-methylpiperazin-1-yl)phenoxy]pyrimidin-2-yl]pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 163247173 |
| Molecular Formula | C31H39N7O4S |
| Molecular Weight | 605.77 g/mol |
| Exact Mass | 605.28 |
| IUPAC Name | 1-methyl-N-[4-[3-(4-methylpentoxy)phenyl]-6-[4-(4-methylpiperazin-1-yl)phenoxy]pyrimidin-2-yl]pyrazole-4-sulfonamide |
| SMILES | CC(C)CCCOc1cccc(-c2cc(Oc3ccc(N4CCN(C)CC4)cc3)nc(NS(=O)(=O)c3cnn(C)c3)n2)c1 |
| InChI | InChI=1S/C31H39N7O4S/c1-23(2)7-6-18-41-27-9-5-8-24(19-27)29-20-30(34-31(33-29)35-43(39,40)28-21-32-37(4)22-28)42-26-12-10-25(11-13-26)38-16-14-36(3)15-17-38/h5,8-13,19-23H,6-7,14-18H2,1-4H3,(H,33,34,35) |
| InChIKey | MQQKVSHAENMKNW-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 114.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.77 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|