C23H31N5O5S — CID 170394535
N-[4-(3-butoxyphenyl)-6-(3-hydroxy-3-methylbutoxy)pyrimidin-2-yl]-1-methylpyrazole-4-sulfonamide (PubChem CID 170394535) has the molecular formula C23H31N5O5S and a molecular weight of 489.60 g/mol. Its IUPAC name is N-[4-(3-butoxyphenyl)-6-(3-hydroxy-3-methylbutoxy)pyrimidin-2-yl]-1-methylpyrazole-4-sulfonamide.
| Compound Name | N-[4-(3-butoxyphenyl)-6-(3-hydroxy-3-methylbutoxy)pyrimidin-2-yl]-1-methylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 170394535 |
| Molecular Formula | C23H31N5O5S |
| Molecular Weight | 489.60 g/mol |
| Exact Mass | 489.20 |
| IUPAC Name | N-[4-(3-butoxyphenyl)-6-(3-hydroxy-3-methylbutoxy)pyrimidin-2-yl]-1-methylpyrazole-4-sulfonamide |
| SMILES | CCCCOc1cccc(-c2cc(OCCC(C)(C)O)nc(NS(=O)(=O)c3cnn(C)c3)n2)c1 |
| InChI | InChI=1S/C23H31N5O5S/c1-5-6-11-32-18-9-7-8-17(13-18)20-14-21(33-12-10-23(2,3)29)26-22(25-20)27-34(30,31)19-15-24-28(4)16-19/h7-9,13-16,29H,5-6,10-12H2,1-4H3,(H,25,26,27) |
| InChIKey | RPESWMTVMXZGEM-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 128.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.60 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|