C24H26ClN3S — CID 163248329
benzenethiol;(Z)-3-(4-chlorophenyl)-3-(2,4,6-trimethylanilino)prop-2-enimidamide (PubChem CID 163248329) has the molecular formula C24H26ClN3S and a molecular weight of 424.01 g/mol. Its IUPAC name is benzenethiol;(Z)-3-(4-chlorophenyl)-3-(2,4,6-trimethylanilino)prop-2-enimidamide.
| Compound Name | benzenethiol;(Z)-3-(4-chlorophenyl)-3-(2,4,6-trimethylanilino)prop-2-enimidamide |
|---|---|
| PubChem CID | 163248329 |
| Molecular Formula | C24H26ClN3S |
| Molecular Weight | 424.01 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | benzenethiol;(Z)-3-(4-chlorophenyl)-3-(2,4,6-trimethylanilino)prop-2-enimidamide |
| SMILES | Sc1ccccc1.[H]/N=C(N)/C=C(\Nc1c(C)cc(C)cc1C)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H20ClN3.C6H6S/c1-11-8-12(2)18(13(3)9-11)22-16(10-17(20)21)14-4-6-15(19)7-5-14;7-6-4-2-1-3-5-6/h4-10,22H,1-3H3,(H3,20,21);1-5,7H/b16-10-; |
| InChIKey | OXPFIXKTCGEHDT-HYMQDMCPSA-N |
| XLogP | 6.63 |
| TPSA | 61.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.01 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|