C22H19N3O3S — CID 163248782
N-[3-(2,6-dimethylphenoxy)quinoxalin-2-yl]benzenesulfonamide (PubChem CID 163248782) has the molecular formula C22H19N3O3S and a molecular weight of 405.48 g/mol. Its IUPAC name is N-[3-(2,6-dimethylphenoxy)quinoxalin-2-yl]benzenesulfonamide.
| Compound Name | N-[3-(2,6-dimethylphenoxy)quinoxalin-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 163248782 |
| Molecular Formula | C22H19N3O3S |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | N-[3-(2,6-dimethylphenoxy)quinoxalin-2-yl]benzenesulfonamide |
| SMILES | Cc1cccc(C)c1Oc1nc2ccccc2nc1NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C22H19N3O3S/c1-15-9-8-10-16(2)20(15)28-22-21(23-18-13-6-7-14-19(18)24-22)25-29(26,27)17-11-4-3-5-12-17/h3-14H,1-2H3,(H,23,25) |
| InChIKey | CRJUBABBBUHXSF-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |