C37H34N4O6 — CID 163249013
N-[4,5-dimethoxy-2-[[4-[2-[(1-methylindol-6-yl)methylamino]ethyl]phenyl]carbamoyl]phenyl]-4-oxochromene-2-carboxamide (PubChem CID 163249013) has the molecular formula C37H34N4O6 and a molecular weight of 630.70 g/mol. Its IUPAC name is N-[4,5-dimethoxy-2-[[4-[2-[(1-methylindol-6-yl)methylamino]ethyl]phenyl]carbamoyl]phenyl]-4-oxochromene-2-carboxamide.
| Compound Name | N-[4,5-dimethoxy-2-[[4-[2-[(1-methylindol-6-yl)methylamino]ethyl]phenyl]carbamoyl]phenyl]-4-oxochromene-2-carboxamide |
|---|---|
| PubChem CID | 163249013 |
| Molecular Formula | C37H34N4O6 |
| Molecular Weight | 630.70 g/mol |
| Exact Mass | 630.25 |
| IUPAC Name | N-[4,5-dimethoxy-2-[[4-[2-[(1-methylindol-6-yl)methylamino]ethyl]phenyl]carbamoyl]phenyl]-4-oxochromene-2-carboxamide |
| SMILES | COc1cc(NC(=O)c2cc(=O)c3ccccc3o2)c(C(=O)Nc2ccc(CCNCc3ccc4ccn(C)c4c3)cc2)cc1OC |
| InChI | InChI=1S/C37H34N4O6/c1-41-17-15-25-11-8-24(18-30(25)41)22-38-16-14-23-9-12-26(13-10-23)39-36(43)28-19-33(45-2)34(46-3)20-29(28)40-37(44)35-21-31(42)27-6-4-5-7-32(27)47-35/h4-13,15,17-21,38H,14,16,22H2,1-3H3,(H,39,43)(H,40,44) |
| InChIKey | UMYLGYOJNPMRRN-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 123.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.70 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|