C28H26N2O6 — CID 174055483
N-[4-ethoxy-2-[(4-ethylphenyl)carbamoyl]-5-methoxyphenyl]-4-oxochromene-2-carboxamide (PubChem CID 174055483) has the molecular formula C28H26N2O6 and a molecular weight of 486.52 g/mol. Its IUPAC name is N-[4-ethoxy-2-[(4-ethylphenyl)carbamoyl]-5-methoxyphenyl]-4-oxochromene-2-carboxamide.
| Compound Name | N-[4-ethoxy-2-[(4-ethylphenyl)carbamoyl]-5-methoxyphenyl]-4-oxochromene-2-carboxamide |
|---|---|
| PubChem CID | 174055483 |
| Molecular Formula | C28H26N2O6 |
| Molecular Weight | 486.52 g/mol |
| Exact Mass | 486.18 |
| IUPAC Name | N-[4-ethoxy-2-[(4-ethylphenyl)carbamoyl]-5-methoxyphenyl]-4-oxochromene-2-carboxamide |
| SMILES | CCOc1cc(C(=O)Nc2ccc(CC)cc2)c(NC(=O)c2cc(=O)c3ccccc3o2)cc1OC |
| InChI | InChI=1S/C28H26N2O6/c1-4-17-10-12-18(13-11-17)29-27(32)20-14-25(35-5-2)24(34-3)15-21(20)30-28(33)26-16-22(31)19-8-6-7-9-23(19)36-26/h6-16H,4-5H2,1-3H3,(H,29,32)(H,30,33) |
| InChIKey | MWHRQHKYHINTHW-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 106.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.52 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |