C35H33N3O6 — CID 163249168
N-[4,5-dimethoxy-2-[[4-[2-(2-phenylethylamino)ethyl]phenyl]carbamoyl]phenyl]-4-oxochromene-2-carboxamide (PubChem CID 163249168) has the molecular formula C35H33N3O6 and a molecular weight of 591.66 g/mol. Its IUPAC name is N-[4,5-dimethoxy-2-[[4-[2-(2-phenylethylamino)ethyl]phenyl]carbamoyl]phenyl]-4-oxochromene-2-carboxamide.
| Compound Name | N-[4,5-dimethoxy-2-[[4-[2-(2-phenylethylamino)ethyl]phenyl]carbamoyl]phenyl]-4-oxochromene-2-carboxamide |
|---|---|
| PubChem CID | 163249168 |
| Molecular Formula | C35H33N3O6 |
| Molecular Weight | 591.66 g/mol |
| Exact Mass | 591.24 |
| IUPAC Name | N-[4,5-dimethoxy-2-[[4-[2-(2-phenylethylamino)ethyl]phenyl]carbamoyl]phenyl]-4-oxochromene-2-carboxamide |
| SMILES | COc1cc(NC(=O)c2cc(=O)c3ccccc3o2)c(C(=O)Nc2ccc(CCNCCc3ccccc3)cc2)cc1OC |
| InChI | InChI=1S/C35H33N3O6/c1-42-31-20-27(28(21-32(31)43-2)38-35(41)33-22-29(39)26-10-6-7-11-30(26)44-33)34(40)37-25-14-12-24(13-15-25)17-19-36-18-16-23-8-4-3-5-9-23/h3-15,20-22,36H,16-19H2,1-2H3,(H,37,40)(H,38,41) |
| InChIKey | PIDOSYBVBDMVCK-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 118.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.66 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|