C13H11BrN2O3 — CID 163249927
2-bromo-1-[6-(oxetan-3-yloxy)-1,5-naphthyridin-4-yl]ethanone (PubChem CID 163249927) has the molecular formula C13H11BrN2O3 and a molecular weight of 323.15 g/mol. Its IUPAC name is 2-bromo-1-[6-(oxetan-3-yloxy)-1,5-naphthyridin-4-yl]ethanone.
| Compound Name | 2-bromo-1-[6-(oxetan-3-yloxy)-1,5-naphthyridin-4-yl]ethanone |
|---|---|
| PubChem CID | 163249927 |
| Molecular Formula | C13H11BrN2O3 |
| Molecular Weight | 323.15 g/mol |
| Exact Mass | 322.00 |
| IUPAC Name | 2-bromo-1-[6-(oxetan-3-yloxy)-1,5-naphthyridin-4-yl]ethanone |
| SMILES | O=C(CBr)c1ccnc2ccc(OC3COC3)nc12 |
| InChI | InChI=1S/C13H11BrN2O3/c14-5-11(17)9-3-4-15-10-1-2-12(16-13(9)10)19-8-6-18-7-8/h1-4,8H,5-7H2 |
| InChIKey | LIYKSBZTEJOPIT-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.15 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|