C11H13N5O — CID 142961518
(Z)-2-hydrazinyl-1-(6-methoxy-1,5-naphthyridin-4-yl)ethenamine (PubChem CID 142961518) has the molecular formula C11H13N5O and a molecular weight of 231.26 g/mol. Its IUPAC name is (Z)-2-hydrazinyl-1-(6-methoxy-1,5-naphthyridin-4-yl)ethenamine.
| Compound Name | (Z)-2-hydrazinyl-1-(6-methoxy-1,5-naphthyridin-4-yl)ethenamine |
|---|---|
| PubChem CID | 142961518 |
| Molecular Formula | C11H13N5O |
| Molecular Weight | 231.26 g/mol |
| Exact Mass | 231.11 |
| IUPAC Name | (Z)-2-hydrazinyl-1-(6-methoxy-1,5-naphthyridin-4-yl)ethenamine |
| SMILES | COc1ccc2nccc(/C(N)=C/NN)c2n1 |
| InChI | InChI=1S/C11H13N5O/c1-17-10-3-2-9-11(16-10)7(4-5-14-9)8(12)6-15-13/h2-6,15H,12-13H2,1H3/b8-6- |
| InChIKey | YMGHCVKTDNAEQX-VURMDHGXSA-N |
| XLogP | 0.36 |
| TPSA | 99.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.26 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|