C10H9FN2O4S — CID 141137958
(6-methoxy-1,5-naphthyridin-4-yl) fluoromethanesulfonate (PubChem CID 141137958) has the molecular formula C10H9FN2O4S and a molecular weight of 272.26 g/mol. Its IUPAC name is (6-methoxy-1,5-naphthyridin-4-yl) fluoromethanesulfonate.
| Compound Name | (6-methoxy-1,5-naphthyridin-4-yl) fluoromethanesulfonate |
|---|---|
| PubChem CID | 141137958 |
| Molecular Formula | C10H9FN2O4S |
| Molecular Weight | 272.26 g/mol |
| Exact Mass | 272.03 |
| IUPAC Name | (6-methoxy-1,5-naphthyridin-4-yl) fluoromethanesulfonate |
| SMILES | COc1ccc2nccc(OS(=O)(=O)CF)c2n1 |
| InChI | InChI=1S/C10H9FN2O4S/c1-16-9-3-2-7-10(13-9)8(4-5-12-7)17-18(14,15)6-11/h2-5H,6H2,1H3 |
| InChIKey | NXCPVBASOBXKPT-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.26 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|