C17H17ClF2N2O — CID 163253568
6-[(4-chloro-2-fluorophenyl)methyl]-3-fluoro-2-piperidin-4-yloxypyridine (PubChem CID 163253568) has the molecular formula C17H17ClF2N2O and a molecular weight of 338.79 g/mol. Its IUPAC name is 6-[(4-chloro-2-fluorophenyl)methyl]-3-fluoro-2-piperidin-4-yloxypyridine.
| Compound Name | 6-[(4-chloro-2-fluorophenyl)methyl]-3-fluoro-2-piperidin-4-yloxypyridine |
|---|---|
| PubChem CID | 163253568 |
| Molecular Formula | C17H17ClF2N2O |
| Molecular Weight | 338.79 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | 6-[(4-chloro-2-fluorophenyl)methyl]-3-fluoro-2-piperidin-4-yloxypyridine |
| SMILES | Fc1cc(Cl)ccc1Cc1ccc(F)c(OC2CCNCC2)n1 |
| InChI | InChI=1S/C17H17ClF2N2O/c18-12-2-1-11(16(20)10-12)9-13-3-4-15(19)17(22-13)23-14-5-7-21-8-6-14/h1-4,10,14,21H,5-9H2 |
| InChIKey | IAVDQGWPWXERKH-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.79 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |