C18H20ClFN2O2 — CID 171572934
2-[(4-chloro-2-fluorophenoxy)methyl]-3-methyl-6-piperidin-4-yloxypyridine (PubChem CID 171572934) has the molecular formula C18H20ClFN2O2 and a molecular weight of 350.82 g/mol. Its IUPAC name is 2-[(4-chloro-2-fluorophenoxy)methyl]-3-methyl-6-piperidin-4-yloxypyridine.
| Compound Name | 2-[(4-chloro-2-fluorophenoxy)methyl]-3-methyl-6-piperidin-4-yloxypyridine |
|---|---|
| PubChem CID | 171572934 |
| Molecular Formula | C18H20ClFN2O2 |
| Molecular Weight | 350.82 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | 2-[(4-chloro-2-fluorophenoxy)methyl]-3-methyl-6-piperidin-4-yloxypyridine |
| SMILES | Cc1ccc(OC2CCNCC2)nc1COc1ccc(Cl)cc1F |
| InChI | InChI=1S/C18H20ClFN2O2/c1-12-2-5-18(24-14-6-8-21-9-7-14)22-16(12)11-23-17-4-3-13(19)10-15(17)20/h2-5,10,14,21H,6-9,11H2,1H3 |
| InChIKey | RSTHIEWLOXFNBC-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.82 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |