About [6-[(4-chloro-2-fluorophenoxy)methyl]-2-pyridinyl] piperidine-4-carboxylate
[6-[(4-chloro-2-fluorophenoxy)methyl]-2-pyridinyl] piperidine-4-carboxylate (PubChem CID 167494457) has the molecular formula C18H18ClFN2O3
and a molecular weight of 364.80 g/mol. Its IUPAC name is [6-[(4-chloro-2-fluorophenoxy)methyl]-2-pyridinyl] piperidine-4-carboxylate.
Molecular Properties
| Compound Name | [6-[(4-chloro-2-fluorophenoxy)methyl]-2-pyridinyl] piperidine-4-carboxylate |
| PubChem CID | 167494457 |
| Molecular Formula | C18H18ClFN2O3 |
| Molecular Weight | 364.80 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | [6-[(4-chloro-2-fluorophenoxy)methyl]-2-pyridinyl] piperidine-4-carboxylate |
| SMILES | O=C(Oc1cccc(COc2ccc(Cl)cc2F)n1)C1CCNCC1 |
| InChI | InChI=1S/C18H18ClFN2O3/c19-13-4-5-16(15(20)10-13)24-11-14-2-1-3-17(22-14)25-18(23)12-6-8-21-9-7-12/h1-5,10,12,21H,6-9,11H2 |
| InChIKey | SFAOJAWTBRVEPY-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.80 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [6-[(4-chloro-2-fluorophenoxy)methyl]-2-pyridinyl] piperidine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-[(4-chloro-2-fluorophenoxy)methyl]-2-pyridinyl] piperidine-4-carboxylate?
The IUPAC name of [6-[(4-chloro-2-fluorophenoxy)methyl]-2-pyridinyl] piperidine-4-carboxylate (CID 167494457) is [6-[(4-chloro-2-fluorophenoxy)methyl]-2-pyridinyl] piperidine-4-carboxylate.
What is the SMILES notation for [6-[(4-chloro-2-fluorophenoxy)methyl]-2-pyridinyl] piperidine-4-carboxylate?
The canonical SMILES for [6-[(4-chloro-2-fluorophenoxy)methyl]-2-pyridinyl] piperidine-4-carboxylate is O=C(Oc1cccc(COc2ccc(Cl)cc2F)n1)C1CCNCC1.
What is the InChIKey of [6-[(4-chloro-2-fluorophenoxy)methyl]-2-pyridinyl] piperidine-4-carboxylate?
The InChIKey is SFAOJAWTBRVEPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18ClFN2O3/c19-13-4-5-16(15(20)10-13)24-11-14-2-1-3-17(22-14)25-18(23)12-6-8-21-9-7-12/h1-5,10,12,21H,6-9,11H2.
What are the key properties of [6-[(4-chloro-2-fluorophenoxy)methyl]-2-pyridinyl] piperidine-4-carboxylate?
[6-[(4-chloro-2-fluorophenoxy)methyl]-2-pyridinyl] piperidine-4-carboxylate has a molecular weight of 364.80 g/mol, XLogP of 3.36, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [6-[(4-chloro-2-fluorophenoxy)methyl]-2-pyridinyl] piperidine-4-carboxylate is sourced from PubChem (CID 167494457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).