C16H18ClFN4O — CID 164602374
2-[(4-chloro-2-fluorophenoxy)methyl]-N-piperidin-4-ylpyrimidin-4-amine (PubChem CID 164602374) has the molecular formula C16H18ClFN4O and a molecular weight of 336.80 g/mol. Its IUPAC name is 2-[(4-chloro-2-fluorophenoxy)methyl]-N-piperidin-4-ylpyrimidin-4-amine.
| Compound Name | 2-[(4-chloro-2-fluorophenoxy)methyl]-N-piperidin-4-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 164602374 |
| Molecular Formula | C16H18ClFN4O |
| Molecular Weight | 336.80 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | 2-[(4-chloro-2-fluorophenoxy)methyl]-N-piperidin-4-ylpyrimidin-4-amine |
| SMILES | Fc1cc(Cl)ccc1OCc1nccc(NC2CCNCC2)n1 |
| InChI | InChI=1S/C16H18ClFN4O/c17-11-1-2-14(13(18)9-11)23-10-16-20-8-5-15(22-16)21-12-3-6-19-7-4-12/h1-2,5,8-9,12,19H,3-4,6-7,10H2,(H,20,21,22) |
| InChIKey | NXVNFWJAYGZVER-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 59.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.80 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |