C17H15F3N4O3 — CID 163254673
N-(6-amino-2,4-dioxo-3-prop-2-ynyl-1H-pyrimidin-5-yl)-3-[4-(trifluoromethyl)phenyl]propanamide (PubChem CID 163254673) has the molecular formula C17H15F3N4O3 and a molecular weight of 380.33 g/mol. Its IUPAC name is N-(6-amino-2,4-dioxo-3-prop-2-ynyl-1H-pyrimidin-5-yl)-3-[4-(trifluoromethyl)phenyl]propanamide.
| Compound Name | N-(6-amino-2,4-dioxo-3-prop-2-ynyl-1H-pyrimidin-5-yl)-3-[4-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 163254673 |
| Molecular Formula | C17H15F3N4O3 |
| Molecular Weight | 380.33 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | N-(6-amino-2,4-dioxo-3-prop-2-ynyl-1H-pyrimidin-5-yl)-3-[4-(trifluoromethyl)phenyl]propanamide |
| SMILES | C#CCn1c(=O)[nH]c(N)c(NC(=O)CCc2ccc(C(F)(F)F)cc2)c1=O |
| InChI | InChI=1S/C17H15F3N4O3/c1-2-9-24-15(26)13(14(21)23-16(24)27)22-12(25)8-5-10-3-6-11(7-4-10)17(18,19)20/h1,3-4,6-7H,5,8-9,21H2,(H,22,25)(H,23,27) |
| InChIKey | QTPWCXXPOMYWHF-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 109.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.33 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|