C23H25BN4O7 — CID 163256906
CID 163256906 (PubChem CID 163256906) has the molecular formula C23H25BN4O7 and a molecular weight of 480.29 g/mol.
| Compound Name | CID 163256906 |
|---|---|
| PubChem CID | 163256906 |
| Molecular Formula | C23H25BN4O7 |
| Molecular Weight | 480.29 g/mol |
| Exact Mass | 480.18 |
| IUPAC Name | — |
| SMILES | [B]c1cn([C@@H]2O[C@H](C(=O)O)[C@H]3OC(C)(C)O[C@H]32)c2ncnc(NCc3ccc(OC)cc3OC)c12 |
| InChI | InChI=1S/C23H25BN4O7/c1-23(2)34-16-17(35-23)21(33-18(16)22(29)30)28-9-13(24)15-19(26-10-27-20(15)28)25-8-11-5-6-12(31-3)7-14(11)32-4/h5-7,9-10,16-18,21H,8H2,1-4H3,(H,29,30)(H,25,26,27)/t16-,17+,18-,21+/m0/s1 |
| InChIKey | RRKITGPSWHGNQC-TWFHAPMSSA-N |
| XLogP | 1.36 |
| TPSA | 126.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.29 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|