C20H23BrN4O6 — CID 163256647
(2S,3R,4R,5R)-2-[5-bromo-4-[(2,4-dimethoxyphenyl)methylamino]pyrrolo[2,3-d]pyrimidin-7-yl]-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 163256647) has the molecular formula C20H23BrN4O6 and a molecular weight of 495.33 g/mol. Its IUPAC name is (2S,3R,4R,5R)-2-[5-bromo-4-[(2,4-dimethoxyphenyl)methylamino]pyrrolo[2,3-d]pyrimidin-7-yl]-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2S,3R,4R,5R)-2-[5-bromo-4-[(2,4-dimethoxyphenyl)methylamino]pyrrolo[2,3-d]pyrimidin-7-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 163256647 |
| Molecular Formula | C20H23BrN4O6 |
| Molecular Weight | 495.33 g/mol |
| Exact Mass | 494.08 |
| IUPAC Name | (2S,3R,4R,5R)-2-[5-bromo-4-[(2,4-dimethoxyphenyl)methylamino]pyrrolo[2,3-d]pyrimidin-7-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | COc1ccc(CNc2ncnc3c2c(Br)cn3[C@H]2O[C@H](CO)[C@H](O)[C@H]2O)c(OC)c1 |
| InChI | InChI=1S/C20H23BrN4O6/c1-29-11-4-3-10(13(5-11)30-2)6-22-18-15-12(21)7-25(19(15)24-9-23-18)20-17(28)16(27)14(8-26)31-20/h3-5,7,9,14,16-17,20,26-28H,6,8H2,1-2H3,(H,22,23,24)/t14-,16+,17-,20+/m1/s1 |
| InChIKey | OAKUJVKLJBXPLA-ASKNOMKYSA-N |
| XLogP | 1.43 |
| TPSA | 131.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.33 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |