C11H12N2 — CID 163257036
7-[(1R)-cyclohexa-2,4-dien-1-yl]-5H-1,3-diazepine (PubChem CID 163257036) has the molecular formula C11H12N2 and a molecular weight of 172.23 g/mol. Its IUPAC name is 7-[(1R)-cyclohexa-2,4-dien-1-yl]-5H-1,3-diazepine.
| Compound Name | 7-[(1R)-cyclohexa-2,4-dien-1-yl]-5H-1,3-diazepine |
|---|---|
| PubChem CID | 163257036 |
| Molecular Formula | C11H12N2 |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.10 |
| IUPAC Name | 7-[(1R)-cyclohexa-2,4-dien-1-yl]-5H-1,3-diazepine |
| SMILES | C1=CC[C@@H](C2=CCC=NC=N2)C=C1 |
| InChI | InChI=1S/C11H12N2/c1-2-5-10(6-3-1)11-7-4-8-12-9-13-11/h1-3,5,7-10H,4,6H2/t10-/m0/s1 |
| InChIKey | NPKFOVYEAWHSOC-JTQLQIEISA-N |
| XLogP | 2.51 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |