C34H38FN9O2 — CID 163257133
[5-(4-ethyl-1,4-diazepan-1-yl)pyrazin-2-yl]-[2-[6-(2-ethyl-5-fluoro-4-hydroxyphenyl)-1H-indazol-3-yl]-4,5,7,8-tetrahydro-1H-imidazo[4,5-d]azepin-6-yl]methanone (PubChem CID 163257133) has the molecular formula C34H38FN9O2 and a molecular weight of 623.74 g/mol. Its IUPAC name is [5-(4-ethyl-1,4-diazepan-1-yl)pyrazin-2-yl]-[2-[6-(2-ethyl-5-fluoro-4-hydroxyphenyl)-1H-indazol-3-yl]-4,5,7,8-tetrahydro-1H-imidazo[4,5-d]azepin-6-yl]methanone.
| Compound Name | [5-(4-ethyl-1,4-diazepan-1-yl)pyrazin-2-yl]-[2-[6-(2-ethyl-5-fluoro-4-hydroxyphenyl)-1H-indazol-3-yl]-4,5,7,8-tetrahydro-1H-imidazo[4,5-d]azepin-6-yl]methanone |
|---|---|
| PubChem CID | 163257133 |
| Molecular Formula | C34H38FN9O2 |
| Molecular Weight | 623.74 g/mol |
| Exact Mass | 623.31 |
| IUPAC Name | [5-(4-ethyl-1,4-diazepan-1-yl)pyrazin-2-yl]-[2-[6-(2-ethyl-5-fluoro-4-hydroxyphenyl)-1H-indazol-3-yl]-4,5,7,8-tetrahydro-1H-imidazo[4,5-d]azepin-6-yl]methanone |
| SMILES | CCc1cc(O)c(F)cc1-c1ccc2c(-c3nc4c([nH]3)CCN(C(=O)c3cnc(N5CCCN(CC)CC5)cn3)CC4)n[nH]c2c1 |
| InChI | InChI=1S/C34H38FN9O2/c1-3-21-17-30(45)25(35)18-24(21)22-6-7-23-28(16-22)40-41-32(23)33-38-26-8-12-44(13-9-27(26)39-33)34(46)29-19-37-31(20-36-29)43-11-5-10-42(4-2)14-15-43/h6-7,16-20,45H,3-5,8-15H2,1-2H3,(H,38,39)(H,40,41) |
| InChIKey | DJEHVDXKKTVBJT-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 130.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.74 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |