C20H17ClFN3O2 — CID 163261052
4-[3-chloro-5-(4-fluoropiperidine-1-carbonyl)pyrrolo[2,3-b]pyridin-1-yl]benzaldehyde (PubChem CID 163261052) has the molecular formula C20H17ClFN3O2 and a molecular weight of 385.83 g/mol. Its IUPAC name is 4-[3-chloro-5-(4-fluoropiperidine-1-carbonyl)pyrrolo[2,3-b]pyridin-1-yl]benzaldehyde.
| Compound Name | 4-[3-chloro-5-(4-fluoropiperidine-1-carbonyl)pyrrolo[2,3-b]pyridin-1-yl]benzaldehyde |
|---|---|
| PubChem CID | 163261052 |
| Molecular Formula | C20H17ClFN3O2 |
| Molecular Weight | 385.83 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | 4-[3-chloro-5-(4-fluoropiperidine-1-carbonyl)pyrrolo[2,3-b]pyridin-1-yl]benzaldehyde |
| SMILES | O=Cc1ccc(-n2cc(Cl)c3cc(C(=O)N4CCC(F)CC4)cnc32)cc1 |
| InChI | InChI=1S/C20H17ClFN3O2/c21-18-11-25(16-3-1-13(12-26)2-4-16)19-17(18)9-14(10-23-19)20(27)24-7-5-15(22)6-8-24/h1-4,9-12,15H,5-8H2 |
| InChIKey | XKOPMVGWJRYDLD-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.83 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|