C22H21ClN4O — CID 164983105
[3-chloro-1-(4-isocyanophenyl)pyrrolo[2,3-b]pyridin-5-yl]-(4,4-dimethylpiperidin-1-yl)methanone (PubChem CID 164983105) has the molecular formula C22H21ClN4O and a molecular weight of 392.89 g/mol. Its IUPAC name is [3-chloro-1-(4-isocyanophenyl)pyrrolo[2,3-b]pyridin-5-yl]-(4,4-dimethylpiperidin-1-yl)methanone.
| Compound Name | [3-chloro-1-(4-isocyanophenyl)pyrrolo[2,3-b]pyridin-5-yl]-(4,4-dimethylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 164983105 |
| Molecular Formula | C22H21ClN4O |
| Molecular Weight | 392.89 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | [3-chloro-1-(4-isocyanophenyl)pyrrolo[2,3-b]pyridin-5-yl]-(4,4-dimethylpiperidin-1-yl)methanone |
| SMILES | [C-]#[N+]c1ccc(-n2cc(Cl)c3cc(C(=O)N4CCC(C)(C)CC4)cnc32)cc1 |
| InChI | InChI=1S/C22H21ClN4O/c1-22(2)8-10-26(11-9-22)21(28)15-12-18-19(23)14-27(20(18)25-13-15)17-6-4-16(24-3)5-7-17/h4-7,12-14H,8-11H2,1-2H3 |
| InChIKey | VIEZLVYRBDINOT-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 42.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.89 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|