C29H39N5O3 — CID 163264067
1-[(1Z)-1-(4-amino-3-methoxyphenyl)buta-1,3-dienyl]-5-ethyl-N-[4-(piperidine-1-carbonyl)cyclohexyl]pyrazole-3-carboxamide (PubChem CID 163264067) has the molecular formula C29H39N5O3 and a molecular weight of 505.66 g/mol. Its IUPAC name is 1-[(1Z)-1-(4-amino-3-methoxyphenyl)buta-1,3-dienyl]-5-ethyl-N-[4-(piperidine-1-carbonyl)cyclohexyl]pyrazole-3-carboxamide.
| Compound Name | 1-[(1Z)-1-(4-amino-3-methoxyphenyl)buta-1,3-dienyl]-5-ethyl-N-[4-(piperidine-1-carbonyl)cyclohexyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 163264067 |
| Molecular Formula | C29H39N5O3 |
| Molecular Weight | 505.66 g/mol |
| Exact Mass | 505.31 |
| IUPAC Name | 1-[(1Z)-1-(4-amino-3-methoxyphenyl)buta-1,3-dienyl]-5-ethyl-N-[4-(piperidine-1-carbonyl)cyclohexyl]pyrazole-3-carboxamide |
| SMILES | C=C/C=C(/c1ccc(N)c(OC)c1)n1nc(C(=O)NC2CCC(C(=O)N3CCCCC3)CC2)cc1CC |
| InChI | InChI=1S/C29H39N5O3/c1-4-9-26(21-12-15-24(30)27(18-21)37-3)34-23(5-2)19-25(32-34)28(35)31-22-13-10-20(11-14-22)29(36)33-16-7-6-8-17-33/h4,9,12,15,18-20,22H,1,5-8,10-11,13-14,16-17,30H2,2-3H3,(H,31,35)/b26-9- |
| InChIKey | HSXQPKOOWZCVFZ-WMDMUMDLSA-N |
| XLogP | 4.41 |
| TPSA | 102.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.66 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|