C19H30O3 — CID 163264197
3-methoxy-2-methylbut-3-en-1-ol;1-(4-propan-2-ylphenyl)butan-1-one (PubChem CID 163264197) has the molecular formula C19H30O3 and a molecular weight of 306.45 g/mol. Its IUPAC name is 3-methoxy-2-methylbut-3-en-1-ol;1-(4-propan-2-ylphenyl)butan-1-one.
| Compound Name | 3-methoxy-2-methylbut-3-en-1-ol;1-(4-propan-2-ylphenyl)butan-1-one |
|---|---|
| PubChem CID | 163264197 |
| Molecular Formula | C19H30O3 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.22 |
| IUPAC Name | 3-methoxy-2-methylbut-3-en-1-ol;1-(4-propan-2-ylphenyl)butan-1-one |
| SMILES | C=C(OC)C(C)CO.CCCC(=O)c1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C13H18O.C6H12O2/c1-4-5-13(14)12-8-6-11(7-9-12)10(2)3;1-5(4-7)6(2)8-3/h6-10H,4-5H2,1-3H3;5,7H,2,4H2,1,3H3 |
| InChIKey | LVDSAUHFSJJHKY-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|