C20H33NOS — CID 163264356
3-methyl-5-methylsulfanylpent-1-en-2-amine;1-(4-propan-2-ylphenyl)butan-1-one (PubChem CID 163264356) has the molecular formula C20H33NOS and a molecular weight of 335.56 g/mol. Its IUPAC name is 3-methyl-5-methylsulfanylpent-1-en-2-amine;1-(4-propan-2-ylphenyl)butan-1-one.
| Compound Name | 3-methyl-5-methylsulfanylpent-1-en-2-amine;1-(4-propan-2-ylphenyl)butan-1-one |
|---|---|
| PubChem CID | 163264356 |
| Molecular Formula | C20H33NOS |
| Molecular Weight | 335.56 g/mol |
| Exact Mass | 335.23 |
| IUPAC Name | 3-methyl-5-methylsulfanylpent-1-en-2-amine;1-(4-propan-2-ylphenyl)butan-1-one |
| SMILES | C=C(N)C(C)CCSC.CCCC(=O)c1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C13H18O.C7H15NS/c1-4-5-13(14)12-8-6-11(7-9-12)10(2)3;1-6(7(2)8)4-5-9-3/h6-10H,4-5H2,1-3H3;6H,2,4-5,8H2,1,3H3 |
| InChIKey | SNRAACFSCMSKSL-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.56 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |