C30H29F5N4O4 — CID 163264692
[1-[(1Z)-1-(3,4-dimethoxyphenyl)buta-1,3-dienyl]-5-ethylpyrazol-3-yl]-[3-methyl-4-(2,3,4,5,6-pentafluorobenzoyl)piperazin-1-yl]methanone (PubChem CID 163264692) has the molecular formula C30H29F5N4O4 and a molecular weight of 604.58 g/mol. Its IUPAC name is [1-[(1Z)-1-(3,4-dimethoxyphenyl)buta-1,3-dienyl]-5-ethylpyrazol-3-yl]-[3-methyl-4-(2,3,4,5,6-pentafluorobenzoyl)piperazin-1-yl]methanone.
| Compound Name | [1-[(1Z)-1-(3,4-dimethoxyphenyl)buta-1,3-dienyl]-5-ethylpyrazol-3-yl]-[3-methyl-4-(2,3,4,5,6-pentafluorobenzoyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 163264692 |
| Molecular Formula | C30H29F5N4O4 |
| Molecular Weight | 604.58 g/mol |
| Exact Mass | 604.21 |
| IUPAC Name | [1-[(1Z)-1-(3,4-dimethoxyphenyl)buta-1,3-dienyl]-5-ethylpyrazol-3-yl]-[3-methyl-4-(2,3,4,5,6-pentafluorobenzoyl)piperazin-1-yl]methanone |
| SMILES | C=C/C=C(/c1ccc(OC)c(OC)c1)n1nc(C(=O)N2CCN(C(=O)c3c(F)c(F)c(F)c(F)c3F)C(C)C2)cc1CC |
| InChI | InChI=1S/C30H29F5N4O4/c1-6-8-20(17-9-10-21(42-4)22(13-17)43-5)39-18(7-2)14-19(36-39)29(40)37-11-12-38(16(3)15-37)30(41)23-24(31)26(33)28(35)27(34)25(23)32/h6,8-10,13-14,16H,1,7,11-12,15H2,2-5H3/b20-8- |
| InChIKey | HMLZHEHMIAYHHA-ZBKNUEDVSA-N |
| XLogP | 5.22 |
| TPSA | 76.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.58 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|