C23H20F3N5O — CID 163267105
4-cyano-N-[4-[[2-(trifluoromethyl)quinazolin-4-yl]amino]cyclohexyl]benzamide (PubChem CID 163267105) has the molecular formula C23H20F3N5O and a molecular weight of 439.44 g/mol. Its IUPAC name is 4-cyano-N-[4-[[2-(trifluoromethyl)quinazolin-4-yl]amino]cyclohexyl]benzamide.
| Compound Name | 4-cyano-N-[4-[[2-(trifluoromethyl)quinazolin-4-yl]amino]cyclohexyl]benzamide |
|---|---|
| PubChem CID | 163267105 |
| Molecular Formula | C23H20F3N5O |
| Molecular Weight | 439.44 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | 4-cyano-N-[4-[[2-(trifluoromethyl)quinazolin-4-yl]amino]cyclohexyl]benzamide |
| SMILES | N#Cc1ccc(C(=O)NC2CCC(Nc3nc(C(F)(F)F)nc4ccccc34)CC2)cc1 |
| InChI | InChI=1S/C23H20F3N5O/c24-23(25,26)22-30-19-4-2-1-3-18(19)20(31-22)28-16-9-11-17(12-10-16)29-21(32)15-7-5-14(13-27)6-8-15/h1-8,16-17H,9-12H2,(H,29,32)(H,28,30,31) |
| InChIKey | GPBSVXMFHOVTDV-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.44 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |