C22H20F4N4O — CID 163267198
4-fluoro-N-[4-[[2-(trifluoromethyl)quinazolin-4-yl]amino]cyclohexyl]benzamide (PubChem CID 163267198) has the molecular formula C22H20F4N4O and a molecular weight of 432.42 g/mol. Its IUPAC name is 4-fluoro-N-[4-[[2-(trifluoromethyl)quinazolin-4-yl]amino]cyclohexyl]benzamide.
| Compound Name | 4-fluoro-N-[4-[[2-(trifluoromethyl)quinazolin-4-yl]amino]cyclohexyl]benzamide |
|---|---|
| PubChem CID | 163267198 |
| Molecular Formula | C22H20F4N4O |
| Molecular Weight | 432.42 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | 4-fluoro-N-[4-[[2-(trifluoromethyl)quinazolin-4-yl]amino]cyclohexyl]benzamide |
| SMILES | O=C(NC1CCC(Nc2nc(C(F)(F)F)nc3ccccc23)CC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C22H20F4N4O/c23-14-7-5-13(6-8-14)20(31)28-16-11-9-15(10-12-16)27-19-17-3-1-2-4-18(17)29-21(30-19)22(24,25)26/h1-8,15-16H,9-12H2,(H,28,31)(H,27,29,30) |
| InChIKey | PYSNSOPWBLELBK-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.42 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |