C22H20F4N2OS — CID 166008956
4-fluoro-N-[4-[[2-(trifluoromethyl)-1-benzothiophen-7-yl]amino]cyclohexyl]benzamide (PubChem CID 166008956) has the molecular formula C22H20F4N2OS and a molecular weight of 436.47 g/mol. Its IUPAC name is 4-fluoro-N-[4-[[2-(trifluoromethyl)-1-benzothiophen-7-yl]amino]cyclohexyl]benzamide.
| Compound Name | 4-fluoro-N-[4-[[2-(trifluoromethyl)-1-benzothiophen-7-yl]amino]cyclohexyl]benzamide |
|---|---|
| PubChem CID | 166008956 |
| Molecular Formula | C22H20F4N2OS |
| Molecular Weight | 436.47 g/mol |
| Exact Mass | 436.12 |
| IUPAC Name | 4-fluoro-N-[4-[[2-(trifluoromethyl)-1-benzothiophen-7-yl]amino]cyclohexyl]benzamide |
| SMILES | O=C(NC1CCC(Nc2cccc3cc(C(F)(F)F)sc23)CC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C22H20F4N2OS/c23-15-6-4-13(5-7-15)21(29)28-17-10-8-16(9-11-17)27-18-3-1-2-14-12-19(22(24,25)26)30-20(14)18/h1-7,12,16-17,27H,8-11H2,(H,28,29) |
| InChIKey | WBRMFKQYTJEVQW-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.47 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |