C14H15FN2O3 — CID 163267810
(3E,4Z)-3-ethylidene-4-(1-fluoroethylidene)-1-(6-methylidene-2-oxopiperidin-3-yl)pyrrolidine-2,5-dione (PubChem CID 163267810) has the molecular formula C14H15FN2O3 and a molecular weight of 278.28 g/mol. Its IUPAC name is (3E,4Z)-3-ethylidene-4-(1-fluoroethylidene)-1-(6-methylidene-2-oxopiperidin-3-yl)pyrrolidine-2,5-dione.
| Compound Name | (3E,4Z)-3-ethylidene-4-(1-fluoroethylidene)-1-(6-methylidene-2-oxopiperidin-3-yl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 163267810 |
| Molecular Formula | C14H15FN2O3 |
| Molecular Weight | 278.28 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | (3E,4Z)-3-ethylidene-4-(1-fluoroethylidene)-1-(6-methylidene-2-oxopiperidin-3-yl)pyrrolidine-2,5-dione |
| SMILES | C=C1CCC(N2C(=O)C(=C(/C)F)/C(=C\C)C2=O)C(=O)N1 |
| InChI | InChI=1S/C14H15FN2O3/c1-4-9-11(8(3)15)14(20)17(13(9)19)10-6-5-7(2)16-12(10)18/h4,10H,2,5-6H2,1,3H3,(H,16,18)/b9-4+,11-8- |
| InChIKey | SNYAIOYGIDHAAL-JTUOORNZSA-N |
| XLogP | 1.34 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.28 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|