About S-(7-amino-7-oxoheptyl) 3-(3-fluorophenyl)propanethioate
S-(7-amino-7-oxoheptyl) 3-(3-fluorophenyl)propanethioate (PubChem CID 163269946) has the molecular formula C16H22FNO2S
and a molecular weight of 311.42 g/mol. Its IUPAC name is S-(7-amino-7-oxoheptyl) 3-(3-fluorophenyl)propanethioate.
Molecular Properties
| Compound Name | S-(7-amino-7-oxoheptyl) 3-(3-fluorophenyl)propanethioate |
| PubChem CID | 163269946 |
| Molecular Formula | C16H22FNO2S |
| Molecular Weight | 311.42 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | S-(7-amino-7-oxoheptyl) 3-(3-fluorophenyl)propanethioate |
| SMILES | NC(=O)CCCCCCSC(=O)CCc1cccc(F)c1 |
| InChI | InChI=1S/C16H22FNO2S/c17-14-7-5-6-13(12-14)9-10-16(20)21-11-4-2-1-3-8-15(18)19/h5-7,12H,1-4,8-11H2,(H2,18,19) |
| InChIKey | KLQXVXOLVHYMKI-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.42 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(7-amino-7-oxoheptyl) 3-(3-fluorophenyl)propanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(7-amino-7-oxoheptyl) 3-(3-fluorophenyl)propanethioate?
The IUPAC name of S-(7-amino-7-oxoheptyl) 3-(3-fluorophenyl)propanethioate (CID 163269946) is S-(7-amino-7-oxoheptyl) 3-(3-fluorophenyl)propanethioate.
What is the SMILES notation for S-(7-amino-7-oxoheptyl) 3-(3-fluorophenyl)propanethioate?
The canonical SMILES for S-(7-amino-7-oxoheptyl) 3-(3-fluorophenyl)propanethioate is NC(=O)CCCCCCSC(=O)CCc1cccc(F)c1.
What is the InChIKey of S-(7-amino-7-oxoheptyl) 3-(3-fluorophenyl)propanethioate?
The InChIKey is KLQXVXOLVHYMKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22FNO2S/c17-14-7-5-6-13(12-14)9-10-16(20)21-11-4-2-1-3-8-15(18)19/h5-7,12H,1-4,8-11H2,(H2,18,19).
What are the key properties of S-(7-amino-7-oxoheptyl) 3-(3-fluorophenyl)propanethioate?
S-(7-amino-7-oxoheptyl) 3-(3-fluorophenyl)propanethioate has a molecular weight of 311.42 g/mol, XLogP of 3.45, 10 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-(7-amino-7-oxoheptyl) 3-(3-fluorophenyl)propanethioate is sourced from PubChem (CID 163269946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).